C9H9ClN4OS2 — CID 3545072
N-[(carbamothioylamino)carbamothioyl]-4-chlorobenzamide (PubChem CID 3545072) has the molecular formula C9H9ClN4OS2 and a molecular weight of 288.79 g/mol. Its IUPAC name is N-[(carbamothioylamino)carbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[(carbamothioylamino)carbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 3545072 |
| Molecular Formula | C9H9ClN4OS2 |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | N-[(carbamothioylamino)carbamothioyl]-4-chlorobenzamide |
| SMILES | NC(=S)NNC(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClN4OS2/c10-6-3-1-5(2-4-6)7(15)12-9(17)14-13-8(11)16/h1-4H,(H3,11,13,16)(H2,12,14,15,17) |
| InChIKey | PISOXJAKPKOOIN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|