C17H12F3N5O2 — CID 127027620
1-pyridin-2-yl-3-[5-pyrimidin-5-yl-2-(trifluoromethoxy)phenyl]urea (PubChem CID 127027620) has the molecular formula C17H12F3N5O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-pyridin-2-yl-3-[5-pyrimidin-5-yl-2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-pyridin-2-yl-3-[5-pyrimidin-5-yl-2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 127027620 |
| Molecular Formula | C17H12F3N5O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-pyridin-2-yl-3-[5-pyrimidin-5-yl-2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccccn1)Nc1cc(-c2cncnc2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H12F3N5O2/c18-17(19,20)27-14-5-4-11(12-8-21-10-22-9-12)7-13(14)24-16(26)25-15-3-1-2-6-23-15/h1-10H,(H2,23,24,25,26) |
| InChIKey | DINGKRMHSGGVIF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |