C12H14ClN5 — CID 127027682
1-[(2,3-dimethylimidazol-3-ium-1-yl)methyl]benzotriazole chloride (PubChem CID 127027682) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 1-[(2,3-dimethylimidazol-3-ium-1-yl)methyl]benzotriazole chloride.
| Compound Name | 1-[(2,3-dimethylimidazol-3-ium-1-yl)methyl]benzotriazole chloride |
|---|---|
| PubChem CID | 127027682 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-[(2,3-dimethylimidazol-3-ium-1-yl)methyl]benzotriazole chloride |
| SMILES | Cc1n(Cn2nnc3ccccc32)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C12H14N5.ClH/c1-10-15(2)7-8-16(10)9-17-12-6-4-3-5-11(12)13-14-17;/h3-8H,9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZTPYEOWNZHMMNG-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|