C24H27N3O3 — CID 127028205
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl pentanoate (PubChem CID 127028205) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl pentanoate.
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl pentanoate |
|---|---|
| PubChem CID | 127028205 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl pentanoate |
| SMILES | CCCCC(=O)OCc1ccc(C(CN)C(=O)Nc2ccc3cnccc3c2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-4-23(28)30-16-17-5-7-18(8-6-17)22(14-25)24(29)27-21-10-9-20-15-26-12-11-19(20)13-21/h5-13,15,22H,2-4,14,16,25H2,1H3,(H,27,29) |
| InChIKey | SXDDEBSPMPOXHW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |