C5H2F9I — CID 12702828
1,1,1,3,3,3-hexafluoro-2-(iodomethyl)-2-(trifluoromethyl)propane (PubChem CID 12702828) has the molecular formula C5H2F9I and a molecular weight of 359.96 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(iodomethyl)-2-(trifluoromethyl)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(iodomethyl)-2-(trifluoromethyl)propane |
|---|---|
| PubChem CID | 12702828 |
| Molecular Formula | C5H2F9I |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(iodomethyl)-2-(trifluoromethyl)propane |
| SMILES | FC(F)(F)C(CI)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F9I/c6-3(7,8)2(1-15,4(9,10)11)5(12,13)14/h1H2 |
| InChIKey | SQBUIDXWXSWADZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|