C24H32O11 — CID 127029014
[(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S)-8-hydroxy-7-methoxy-1-oxo-3-[(E)-pent-3-enyl]-3,4-dihydroisochromen-6-yl]oxy]-3-methoxyoxan-2-yl]methyl acetate (PubChem CID 127029014) has the molecular formula C24H32O11 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S)-8-hydroxy-7-methoxy-1-oxo-3-[(E)-pent-3-enyl]-3,4-dihydroisochromen-6-yl]oxy]-3-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S)-8-hydroxy-7-methoxy-1-oxo-3-[(E)-pent-3-enyl]-3,4-dihydroisochromen-6-yl]oxy]-3-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 127029014 |
| Molecular Formula | C24H32O11 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[[(3S)-8-hydroxy-7-methoxy-1-oxo-3-[(E)-pent-3-enyl]-3,4-dihydroisochromen-6-yl]oxy]-3-methoxyoxan-2-yl]methyl acetate |
| SMILES | C/C=C/CC[C@H]1Cc2cc(O[C@@H]3O[C@H](COC(C)=O)[C@@H](OC)[C@H](O)[C@H]3O)c(OC)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H32O11/c1-5-6-7-8-14-9-13-10-15(21(30-3)18(26)17(13)23(29)33-14)34-24-20(28)19(27)22(31-4)16(35-24)11-32-12(2)25/h5-6,10,14,16,19-20,22,24,26-28H,7-9,11H2,1-4H3/b6-5+/t14-,16+,19+,20+,22+,24+/m0/s1 |
| InChIKey | CVLZLWGXXKRTRG-MGWBVCLZSA-N |
| XLogP | 1.24 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|