C30H46O4 — CID 127029459
(4R,4aR,6aR,6bS,8R,8aS,14aR,14bS)-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-2,4a,5,6,7,8,9,10,12,14a-decahydro-1H-picen-3-one (PubChem CID 127029459) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (4R,4aR,6aR,6bS,8R,8aS,14aR,14bS)-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-2,4a,5,6,7,8,9,10,12,14a-decahydro-1H-picen-3-one.
| Compound Name | (4R,4aR,6aR,6bS,8R,8aS,14aR,14bS)-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-2,4a,5,6,7,8,9,10,12,14a-decahydro-1H-picen-3-one |
|---|---|
| PubChem CID | 127029459 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (4R,4aR,6aR,6bS,8R,8aS,14aR,14bS)-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-2,4a,5,6,7,8,9,10,12,14a-decahydro-1H-picen-3-one |
| SMILES | CC1(C)CC[C@@]2(CO)C(=C3C=C[C@@H]4[C@@]5(C)CCC(=O)[C@@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H]2O)C1 |
| InChI | InChI=1S/C30H46O4/c1-25(2)13-14-30(18-32)20(15-25)19-7-8-22-26(3)11-10-23(33)27(4,17-31)21(26)9-12-28(22,5)29(19,6)16-24(30)34/h7-8,21-22,24,31-32,34H,9-18H2,1-6H3/t21-,22-,24-,26+,27+,28-,29-,30-/m1/s1 |
| InChIKey | CFBUOQORLNTDIP-NKBLFQKYSA-N |
| XLogP | 5.21 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |