C30H48O4 — CID 154831756
(3R,4S,4aS,6aS,6bR,8R,8aR,14aS,14bR)-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,14a-dodecahydropicene-3,8-diol (PubChem CID 154831756) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (3R,4S,4aS,6aS,6bR,8R,8aR,14aS,14bR)-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,14a-dodecahydropicene-3,8-diol.
| Compound Name | (3R,4S,4aS,6aS,6bR,8R,8aR,14aS,14bR)-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,14a-dodecahydropicene-3,8-diol |
|---|---|
| PubChem CID | 154831756 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (3R,4S,4aS,6aS,6bR,8R,8aR,14aS,14bR)-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,14a-dodecahydropicene-3,8-diol |
| SMILES | CC1(C)CC[C@]2(CO)C(=C3C=C[C@H]4[C@]5(C)CC[C@@H](O)[C@](C)(CO)[C@H]5CC[C@]4(C)[C@@]3(C)C[C@H]2O)C1 |
| InChI | InChI=1S/C30H48O4/c1-25(2)13-14-30(18-32)20(15-25)19-7-8-22-26(3)11-10-23(33)27(4,17-31)21(26)9-12-28(22,5)29(19,6)16-24(30)34/h7-8,21-24,31-34H,9-18H2,1-6H3/t21-,22-,23+,24+,26+,27+,28-,29-,30-/m0/s1 |
| InChIKey | QGNVMEXLLPGQEV-XTLBRALSSA-N |
| XLogP | 5.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |