C20H14ClFN2O3 — CID 127030339
N-[4-(4-chloro-3-oxo-1H-isoindol-2-yl)-2-fluorophenyl]-3-methylfuran-2-carboxamide (PubChem CID 127030339) has the molecular formula C20H14ClFN2O3 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[4-(4-chloro-3-oxo-1H-isoindol-2-yl)-2-fluorophenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[4-(4-chloro-3-oxo-1H-isoindol-2-yl)-2-fluorophenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 127030339 |
| Molecular Formula | C20H14ClFN2O3 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[4-(4-chloro-3-oxo-1H-isoindol-2-yl)-2-fluorophenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(N2Cc3cccc(Cl)c3C2=O)cc1F |
| InChI | InChI=1S/C20H14ClFN2O3/c1-11-7-8-27-18(11)19(25)23-16-6-5-13(9-15(16)22)24-10-12-3-2-4-14(21)17(12)20(24)26/h2-9H,10H2,1H3,(H,23,25) |
| InChIKey | KCPKPYOQOIGRML-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |