C21H15FN2O4 — CID 162648102
N-[4-(1,3-dioxoisoindol-2-yl)-2-fluoro-5-methylphenyl]-3-methylfuran-2-carboxamide (PubChem CID 162648102) has the molecular formula C21H15FN2O4 and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)-2-fluoro-5-methylphenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)-2-fluoro-5-methylphenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 162648102 |
| Molecular Formula | C21H15FN2O4 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)-2-fluoro-5-methylphenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2occc2C)c(F)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H15FN2O4/c1-11-7-8-28-18(11)19(25)23-16-9-12(2)17(10-15(16)22)24-20(26)13-5-3-4-6-14(13)21(24)27/h3-10H,1-2H3,(H,23,25) |
| InChIKey | WMBNMWWQJFWLEY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|