C20H15F3N2O4 — CID 162659650
N-[4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,6-trifluorophenyl]-3-methylfuran-2-carboxamide (PubChem CID 162659650) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,6-trifluorophenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,6-trifluorophenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 162659650 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,6-trifluorophenyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1c(F)cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)c1F |
| InChI | InChI=1S/C20H15F3N2O4/c1-9-6-7-29-17(9)18(26)24-16-12(21)8-13(14(22)15(16)23)25-19(27)10-4-2-3-5-11(10)20(25)28/h6-8H,2-5H2,1H3,(H,24,26) |
| InChIKey | SRBUHKFXLGNPMU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|