C17H13FN2O3 — CID 134092297
N-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]prop-2-ynamide (PubChem CID 134092297) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is N-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]prop-2-ynamide.
| Compound Name | N-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 134092297 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]prop-2-ynamide |
| SMILES | C#CC(=O)Nc1ccc(F)c(N2C(=O)C3=C(CCCC3)C2=O)c1 |
| InChI | InChI=1S/C17H13FN2O3/c1-2-15(21)19-10-7-8-13(18)14(9-10)20-16(22)11-5-3-4-6-12(11)17(20)23/h1,7-9H,3-6H2,(H,19,21) |
| InChIKey | UTCIBVVVCICJEP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|