C18H16ClFN2O3 — CID 169101158
(E)-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]but-2-enamide (PubChem CID 169101158) has the molecular formula C18H16ClFN2O3 and a molecular weight of 362.79 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]but-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]but-2-enamide |
|---|---|
| PubChem CID | 169101158 |
| Molecular Formula | C18H16ClFN2O3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (E)-N-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C18H16ClFN2O3/c1-2-5-16(23)21-14-9-15(13(20)8-12(14)19)22-17(24)10-6-3-4-7-11(10)18(22)25/h2,5,8-9H,3-4,6-7H2,1H3,(H,21,23)/b5-2+ |
| InChIKey | XQHWYFPPLOTMJI-GORDUTHDSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|