C15H11FINO4 — CID 67866615
5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-iodobenzoic acid (PubChem CID 67866615) has the molecular formula C15H11FINO4 and a molecular weight of 415.16 g/mol. Its IUPAC name is 5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-iodobenzoic acid.
| Compound Name | 5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-iodobenzoic acid |
|---|---|
| PubChem CID | 67866615 |
| Molecular Formula | C15H11FINO4 |
| Molecular Weight | 415.16 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-iodobenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1I |
| InChI | InChI=1S/C15H11FINO4/c16-10-6-11(17)9(15(21)22)5-12(10)18-13(19)7-3-1-2-4-8(7)14(18)20/h5-6H,1-4H2,(H,21,22) |
| InChIKey | OMFUWKZXUBNZOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|