C15H12INO4 — CID 167333172
4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-3-iodobenzoic acid (PubChem CID 167333172) has the molecular formula C15H12INO4 and a molecular weight of 397.17 g/mol. Its IUPAC name is 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-3-iodobenzoic acid.
| Compound Name | 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-3-iodobenzoic acid |
|---|---|
| PubChem CID | 167333172 |
| Molecular Formula | C15H12INO4 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-3-iodobenzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)C3=C(CCCC3)C2=O)c(I)c1 |
| InChI | InChI=1S/C15H12INO4/c16-11-7-8(15(20)21)5-6-12(11)17-13(18)9-3-1-2-4-10(9)14(17)19/h5-7H,1-4H2,(H,20,21) |
| InChIKey | YYILDJVTEOQRQD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|