C20H20N4O3 — CID 127030603
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] 2-aminoacetate (PubChem CID 127030603) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] 2-aminoacetate.
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] 2-aminoacetate |
|---|---|
| PubChem CID | 127030603 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] 2-aminoacetate |
| SMILES | NCC(=O)Oc1ccc(C(CN)C(=O)Nc2ccc3cnccc3c2)cc1 |
| InChI | InChI=1S/C20H20N4O3/c21-10-18(13-2-5-17(6-3-13)27-19(25)11-22)20(26)24-16-4-1-15-12-23-8-7-14(15)9-16/h1-9,12,18H,10-11,21-22H2,(H,24,26) |
| InChIKey | OGSCJKMJPCFQGQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|