About 5-anilinothiophen-3-one
5-anilinothiophen-3-one (PubChem CID 12703092) has the molecular formula C10H9NOS
and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-anilinothiophen-3-one.
Molecular Properties
| Compound Name | 5-anilinothiophen-3-one |
| PubChem CID | 12703092 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 5-anilinothiophen-3-one |
| SMILES | O=C1C=C(Nc2ccccc2)SC1 |
| InChI | InChI=1S/C10H9NOS/c12-9-6-10(13-7-9)11-8-4-2-1-3-5-8/h1-6,11H,7H2 |
| InChIKey | RAYKYACEHHVKPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-anilinothiophen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-anilinothiophen-3-one?
The IUPAC name of 5-anilinothiophen-3-one (CID 12703092) is 5-anilinothiophen-3-one.
What is the SMILES notation for 5-anilinothiophen-3-one?
The canonical SMILES for 5-anilinothiophen-3-one is O=C1C=C(Nc2ccccc2)SC1.
What is the InChIKey of 5-anilinothiophen-3-one?
The InChIKey is RAYKYACEHHVKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c12-9-6-10(13-7-9)11-8-4-2-1-3-5-8/h1-6,11H,7H2.
What are the key properties of 5-anilinothiophen-3-one?
5-anilinothiophen-3-one has a molecular weight of 191.26 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-anilinothiophen-3-one is sourced from PubChem (CID 12703092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).