C12H13NOS — CID 72711038
5-(3,4-dimethylanilino)thiophen-3-one (PubChem CID 72711038) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-(3,4-dimethylanilino)thiophen-3-one.
| Compound Name | 5-(3,4-dimethylanilino)thiophen-3-one |
|---|---|
| PubChem CID | 72711038 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-(3,4-dimethylanilino)thiophen-3-one |
| SMILES | Cc1ccc(NC2=CC(=O)CS2)cc1C |
| InChI | InChI=1S/C12H13NOS/c1-8-3-4-10(5-9(8)2)13-12-6-11(14)7-15-12/h3-6,13H,7H2,1-2H3 |
| InChIKey | ONXMVKIYYGEYFD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |