C12H14N2O2S — CID 86576606
4-aminooxy-5-(3,4-dimethylanilino)thiophen-3-one (PubChem CID 86576606) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-aminooxy-5-(3,4-dimethylanilino)thiophen-3-one.
| Compound Name | 4-aminooxy-5-(3,4-dimethylanilino)thiophen-3-one |
|---|---|
| PubChem CID | 86576606 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-aminooxy-5-(3,4-dimethylanilino)thiophen-3-one |
| SMILES | Cc1ccc(NC2=C(ON)C(=O)CS2)cc1C |
| InChI | InChI=1S/C12H14N2O2S/c1-7-3-4-9(5-8(7)2)14-12-11(16-13)10(15)6-17-12/h3-5,14H,6,13H2,1-2H3 |
| InChIKey | FVNRAURACZNASK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|