C16H20N2O2S — CID 86576646
4-(cyclopropylmethylamino)oxy-5-(3,4-dimethylanilino)thiophen-3-one (PubChem CID 86576646) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-(cyclopropylmethylamino)oxy-5-(3,4-dimethylanilino)thiophen-3-one.
| Compound Name | 4-(cyclopropylmethylamino)oxy-5-(3,4-dimethylanilino)thiophen-3-one |
|---|---|
| PubChem CID | 86576646 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(cyclopropylmethylamino)oxy-5-(3,4-dimethylanilino)thiophen-3-one |
| SMILES | Cc1ccc(NC2=C(ONCC3CC3)C(=O)CS2)cc1C |
| InChI | InChI=1S/C16H20N2O2S/c1-10-3-6-13(7-11(10)2)18-16-15(14(19)9-21-16)20-17-8-12-4-5-12/h3,6-7,12,17-18H,4-5,8-9H2,1-2H3 |
| InChIKey | ZUTOYLNZKYJGID-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|