C14H18N2O2S — CID 86576607
5-(3,4-dimethylanilino)-4-(ethylaminooxy)thiophen-3-one (PubChem CID 86576607) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-(3,4-dimethylanilino)-4-(ethylaminooxy)thiophen-3-one.
| Compound Name | 5-(3,4-dimethylanilino)-4-(ethylaminooxy)thiophen-3-one |
|---|---|
| PubChem CID | 86576607 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-(3,4-dimethylanilino)-4-(ethylaminooxy)thiophen-3-one |
| SMILES | CCNOC1=C(Nc2ccc(C)c(C)c2)SCC1=O |
| InChI | InChI=1S/C14H18N2O2S/c1-4-15-18-13-12(17)8-19-14(13)16-11-6-5-9(2)10(3)7-11/h5-7,15-16H,4,8H2,1-3H3 |
| InChIKey | QVOORPFQUQSLMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|