C7H12ClN3OSe — CID 127031360
(3,5-dimethyl-1,2-oxazol-4-yl)methyl carbamimidoselenoate;hydrochloride (PubChem CID 127031360) has the molecular formula C7H12ClN3OSe and a molecular weight of 268.61 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl carbamimidoselenoate;hydrochloride.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl carbamimidoselenoate;hydrochloride |
|---|---|
| PubChem CID | 127031360 |
| Molecular Formula | C7H12ClN3OSe |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl carbamimidoselenoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)[Se]Cc1c(C)noc1C |
| InChI | InChI=1S/C7H11N3OSe.ClH/c1-4-6(3-12-7(8)9)5(2)11-10-4;/h3H2,1-2H3,(H3,8,9);1H |
| InChIKey | XTTPSAYNTQZOJW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|