C30H27N5O3 — CID 127033213
1-(3-methoxyphenyl)-3-[4-[[4-[(4-methoxyphenyl)methyl]phthalazin-1-yl]amino]phenyl]urea (PubChem CID 127033213) has the molecular formula C30H27N5O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[4-[[4-[(4-methoxyphenyl)methyl]phthalazin-1-yl]amino]phenyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[4-[[4-[(4-methoxyphenyl)methyl]phthalazin-1-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 127033213 |
| Molecular Formula | C30H27N5O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[4-[[4-[(4-methoxyphenyl)methyl]phthalazin-1-yl]amino]phenyl]urea |
| SMILES | COc1ccc(Cc2nnc(Nc3ccc(NC(=O)Nc4cccc(OC)c4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H27N5O3/c1-37-24-16-10-20(11-17-24)18-28-26-8-3-4-9-27(26)29(35-34-28)31-21-12-14-22(15-13-21)32-30(36)33-23-6-5-7-25(19-23)38-2/h3-17,19H,18H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | ROHUTABMYMEGTC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |