C27H25NO7 — CID 127033588
(3E)-5-methoxy-3-[[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]methylidene]-1H-indol-2-one (PubChem CID 127033588) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is (3E)-5-methoxy-3-[[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-methoxy-3-[[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 127033588 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (3E)-5-methoxy-3-[[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)/C(=C\c1cc(C(=O)c3cc(OC)c(OC)c(OC)c3)ccc1OC)C(=O)N2 |
| InChI | InChI=1S/C27H25NO7/c1-31-18-7-8-21-19(14-18)20(27(30)28-21)11-16-10-15(6-9-22(16)32-2)25(29)17-12-23(33-3)26(35-5)24(13-17)34-4/h6-14H,1-5H3,(H,28,30)/b20-11+ |
| InChIKey | LIXLSIIYLVFCHM-RGVLZGJSSA-N |
| XLogP | 4.45 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|