C18H17NO4 — CID 5353678
(3Z)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 5353678) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3Z)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 5353678 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3Z)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(OC)c(/C=C2\C(=O)Nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C18H17NO4/c1-21-11-8-16(22-2)14(17(9-11)23-3)10-13-12-6-4-5-7-15(12)19-18(13)20/h4-10H,1-3H3,(H,19,20)/b13-10- |
| InChIKey | JBJYTZXCZDNOJW-RAXLEYEMSA-N |
| XLogP | 3.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|