About 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine
4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 127034649) has the molecular formula C14H9N3OS2
and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 127034649 |
| Molecular Formula | C14H9N3OS2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | c1coc(-c2ncnc3[nH]cc(Sc4cccs4)c23)c1 |
| InChI | InChI=1S/C14H9N3OS2/c1-3-9(18-5-1)13-12-10(20-11-4-2-6-19-11)7-15-14(12)17-8-16-13/h1-8H,(H,15,16,17) |
| InChIKey | LITMOTIYEUJTBW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (CID 127034649) is 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is c1coc(-c2ncnc3[nH]cc(Sc4cccs4)c23)c1.
What is the InChIKey of 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is LITMOTIYEUJTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3OS2/c1-3-9(18-5-1)13-12-10(20-11-4-2-6-19-11)7-15-14(12)17-8-16-13/h1-8H,(H,15,16,17).
What are the key properties of 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 299.38 g/mol, XLogP of 4.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-5-thiophen-2-ylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 127034649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).