C17H21Cl3N4O — CID 127034913
7-[[5-(methylaminomethyl)-3-pyridinyl]oxymethyl]quinolin-2-amine;trihydrochloride (PubChem CID 127034913) has the molecular formula C17H21Cl3N4O and a molecular weight of 403.74 g/mol. Its IUPAC name is 7-[[5-(methylaminomethyl)-3-pyridinyl]oxymethyl]quinolin-2-amine;trihydrochloride.
| Compound Name | 7-[[5-(methylaminomethyl)-3-pyridinyl]oxymethyl]quinolin-2-amine;trihydrochloride |
|---|---|
| PubChem CID | 127034913 |
| Molecular Formula | C17H21Cl3N4O |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 7-[[5-(methylaminomethyl)-3-pyridinyl]oxymethyl]quinolin-2-amine;trihydrochloride |
| SMILES | CNCc1cncc(OCc2ccc3ccc(N)nc3c2)c1.Cl.Cl.Cl |
| InChI | InChI=1S/C17H18N4O.3ClH/c1-19-8-13-6-15(10-20-9-13)22-11-12-2-3-14-4-5-17(18)21-16(14)7-12;;;/h2-7,9-10,19H,8,11H2,1H3,(H2,18,21);3*1H |
| InChIKey | RDBIEICONZKFIZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |