C11H14N3P — CID 171501697
7-(methylaminomethyl)-3-phosphanylquinolin-2-amine (PubChem CID 171501697) has the molecular formula C11H14N3P and a molecular weight of 219.23 g/mol. Its IUPAC name is 7-(methylaminomethyl)-3-phosphanylquinolin-2-amine.
| Compound Name | 7-(methylaminomethyl)-3-phosphanylquinolin-2-amine |
|---|---|
| PubChem CID | 171501697 |
| Molecular Formula | C11H14N3P |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 7-(methylaminomethyl)-3-phosphanylquinolin-2-amine |
| SMILES | CNCc1ccc2cc(P)c(N)nc2c1 |
| InChI | InChI=1S/C11H14N3P/c1-13-6-7-2-3-8-5-10(15)11(12)14-9(8)4-7/h2-5,13H,6,15H2,1H3,(H2,12,14) |
| InChIKey | UHWQOXGOYSQQMU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|