C31H34N2O8 — CID 127035236
ethyl 1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-4-(4-methoxyphenyl)-2-oxo-6-propan-2-ylpyrimidine-5-carboxylate (PubChem CID 127035236) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is ethyl 1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-4-(4-methoxyphenyl)-2-oxo-6-propan-2-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-4-(4-methoxyphenyl)-2-oxo-6-propan-2-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 127035236 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | ethyl 1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-4-(4-methoxyphenyl)-2-oxo-6-propan-2-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)nc(=O)n(Cc2ccc(/C(O)=C/C(=O)C(=O)OC(C)C)cc2)c1C(C)C |
| InChI | InChI=1S/C31H34N2O8/c1-7-40-30(37)26-27(22-12-14-23(39-6)15-13-22)32-31(38)33(28(26)18(2)3)17-20-8-10-21(11-9-20)24(34)16-25(35)29(36)41-19(4)5/h8-16,18-19,34H,7,17H2,1-6H3/b24-16- |
| InChIKey | LIICZSHJQCOBNW-JLPGSUDCSA-N |
| XLogP | 4.69 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|