C29H30N2O7 — CID 127035235
ethyl 6-ethyl-1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-2-oxo-4-phenylpyrimidine-5-carboxylate (PubChem CID 127035235) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is ethyl 6-ethyl-1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-2-oxo-4-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 6-ethyl-1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-2-oxo-4-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 127035235 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | ethyl 6-ethyl-1-[[4-[(Z)-1-hydroxy-3,4-dioxo-4-propan-2-yloxybut-1-enyl]phenyl]methyl]-2-oxo-4-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc(=O)n(Cc2ccc(/C(O)=C/C(=O)C(=O)OC(C)C)cc2)c1CC |
| InChI | InChI=1S/C29H30N2O7/c1-5-22-25(28(35)37-6-2)26(21-10-8-7-9-11-21)30-29(36)31(22)17-19-12-14-20(15-13-19)23(32)16-24(33)27(34)38-18(3)4/h7-16,18,32H,5-6,17H2,1-4H3/b23-16- |
| InChIKey | FMBMKZYNSXENBK-KQWNVCNZSA-N |
| XLogP | 4.12 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|