C11H17N5O — CID 127035703
2-[(1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol (PubChem CID 127035703) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-[(1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[(1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 127035703 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[(1-tert-butylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol |
| SMILES | CC(C)(C)n1ncc2c(NCCO)ncnc21 |
| InChI | InChI=1S/C11H17N5O/c1-11(2,3)16-10-8(6-15-16)9(12-4-5-17)13-7-14-10/h6-7,17H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | HVIOFAORNWHAJN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |