C9H17NO7 — CID 127037129
(2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-(3-hydroxypropyl)oxolane-2-carboxamide (PubChem CID 127037129) has the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-(3-hydroxypropyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-(3-hydroxypropyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 127037129 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)-N-(3-hydroxypropyl)oxolane-2-carboxamide |
| SMILES | O=C(NCCCO)[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO7/c11-3-1-2-10-8(15)6-5(13)7(14)9(16,4-12)17-6/h5-7,11-14,16H,1-4H2,(H,10,15)/t5-,6+,7+,9-/m1/s1 |
| InChIKey | TUPAMRAKLLGOJP-UTSKPXGSSA-N |
| XLogP | -3.71 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|