C25H31N3O3S — CID 127037682
N-[1-[2-(2-propan-2-ylphenoxy)ethyl]piperidin-4-yl]isoquinoline-4-sulfonamide (PubChem CID 127037682) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-[1-[2-(2-propan-2-ylphenoxy)ethyl]piperidin-4-yl]isoquinoline-4-sulfonamide.
| Compound Name | N-[1-[2-(2-propan-2-ylphenoxy)ethyl]piperidin-4-yl]isoquinoline-4-sulfonamide |
|---|---|
| PubChem CID | 127037682 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[1-[2-(2-propan-2-ylphenoxy)ethyl]piperidin-4-yl]isoquinoline-4-sulfonamide |
| SMILES | CC(C)c1ccccc1OCCN1CCC(NS(=O)(=O)c2cncc3ccccc23)CC1 |
| InChI | InChI=1S/C25H31N3O3S/c1-19(2)22-8-5-6-10-24(22)31-16-15-28-13-11-21(12-14-28)27-32(29,30)25-18-26-17-20-7-3-4-9-23(20)25/h3-10,17-19,21,27H,11-16H2,1-2H3 |
| InChIKey | KXVBUWHQNVNMBC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |