C30H49NO5S — CID 127037938
methyl 10-[2-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-2-oxoethyl]sulfanyloctadecanoate (PubChem CID 127037938) has the molecular formula C30H49NO5S and a molecular weight of 535.79 g/mol. Its IUPAC name is methyl 10-[2-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-2-oxoethyl]sulfanyloctadecanoate.
| Compound Name | methyl 10-[2-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-2-oxoethyl]sulfanyloctadecanoate |
|---|---|
| PubChem CID | 127037938 |
| Molecular Formula | C30H49NO5S |
| Molecular Weight | 535.79 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | methyl 10-[2-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-2-oxoethyl]sulfanyloctadecanoate |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)OC)SCC(=O)N[C@H](C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C30H49NO5S/c1-4-5-6-7-10-16-21-26(22-17-11-8-9-12-18-23-28(33)35-2)37-24-27(32)31-29(30(34)36-3)25-19-14-13-15-20-25/h13-15,19-20,26,29H,4-12,16-18,21-24H2,1-3H3,(H,31,32)/t26?,29-/m0/s1 |
| InChIKey | CZGCEDSBPRAIMX-BTMGADRYSA-N |
| XLogP | 7.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.79 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|