C18H23BrF3N7O4 — CID 127038146
1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[3-(diaminomethylideneamino)propyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127038146) has the molecular formula C18H23BrF3N7O4 and a molecular weight of 538.33 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[3-(diaminomethylideneamino)propyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[3-(diaminomethylideneamino)propyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127038146 |
| Molecular Formula | C18H23BrF3N7O4 |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[3-(diaminomethylideneamino)propyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CCn2cc(C(=O)NCCCN=C(N)N)nn2)cc1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22BrN7O2.C2HF3O2/c1-26-14-4-3-11(9-12(14)17)5-8-24-10-13(22-23-24)15(25)20-6-2-7-21-16(18)19;3-2(4,5)1(6)7/h3-4,9-10H,2,5-8H2,1H3,(H,20,25)(H4,18,19,21);(H,6,7) |
| InChIKey | KRBZNGQVZLHIKL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 170.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|