C19H25BrF3N7O4 — CID 127039850
1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[4-(diaminomethylideneamino)butyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127039850) has the molecular formula C19H25BrF3N7O4 and a molecular weight of 552.35 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[4-(diaminomethylideneamino)butyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[4-(diaminomethylideneamino)butyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127039850 |
| Molecular Formula | C19H25BrF3N7O4 |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 1-[2-(3-bromo-4-methoxyphenyl)ethyl]-N-[4-(diaminomethylideneamino)butyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CCn2cc(C(=O)NCCCCN=C(N)N)nn2)cc1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24BrN7O2.C2HF3O2/c1-27-15-5-4-12(10-13(15)18)6-9-25-11-14(23-24-25)16(26)21-7-2-3-8-22-17(19)20;3-2(4,5)1(6)7/h4-5,10-11H,2-3,6-9H2,1H3,(H,21,26)(H4,19,20,22);(H,6,7) |
| InChIKey | JJTAXJWEZPUMSJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 170.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|