C25H24F2N6O3S — CID 127038305
6-(2,4-difluorophenyl)sulfonyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 127038305) has the molecular formula C25H24F2N6O3S and a molecular weight of 526.57 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfonyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,4-difluorophenyl)sulfonyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 127038305 |
| Molecular Formula | C25H24F2N6O3S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfonyl-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(S(=O)(=O)c5ccc(F)cc5F)c(=O)n(C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H24F2N6O3S/c1-31-9-11-33(12-10-31)19-6-4-18(5-7-19)29-25-28-15-16-13-22(24(34)32(2)23(16)30-25)37(35,36)21-8-3-17(26)14-20(21)27/h3-8,13-15H,9-12H2,1-2H3,(H,28,29,30) |
| InChIKey | HKQBFMWJTDTFQT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|