C15H22O2 — CID 127038501
(2S,3aS,4R)-2-(hydroxymethyl)-2,4,6-trimethylspiro[3,3a-dihydroindene-5,1'-cyclopropane]-4-ol (PubChem CID 127038501) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S,3aS,4R)-2-(hydroxymethyl)-2,4,6-trimethylspiro[3,3a-dihydroindene-5,1'-cyclopropane]-4-ol.
| Compound Name | (2S,3aS,4R)-2-(hydroxymethyl)-2,4,6-trimethylspiro[3,3a-dihydroindene-5,1'-cyclopropane]-4-ol |
|---|---|
| PubChem CID | 127038501 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2S,3aS,4R)-2-(hydroxymethyl)-2,4,6-trimethylspiro[3,3a-dihydroindene-5,1'-cyclopropane]-4-ol |
| SMILES | CC1=CC2=C[C@@](C)(CO)C[C@@H]2[C@@](C)(O)C12CC2 |
| InChI | InChI=1S/C15H22O2/c1-10-6-11-7-13(2,9-16)8-12(11)14(3,17)15(10)4-5-15/h6-7,12,16-17H,4-5,8-9H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | HATGYIKPEPJDJM-BFHYXJOUSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |