C19H24FN3O3 — CID 127038607
1-[1-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 127038607) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-[1-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[1-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 127038607 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[1-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC(C(=O)N1CCN(c2ccc(F)cc2)CC1)N1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C19H24FN3O3/c1-13(23-16(24)12-19(2,3)18(23)26)17(25)22-10-8-21(9-11-22)15-6-4-14(20)5-7-15/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | HMOCUGNCCATCJY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|