C21H24N4O5 — CID 7830186
(3aR,7aS)-2-[(2S)-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7830186) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is (3aR,7aS)-2-[(2S)-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[(2S)-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7830186 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3aR,7aS)-2-[(2S)-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H](C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C21H24N4O5/c1-14(24-20(27)17-4-2-3-5-18(17)21(24)28)19(26)23-12-10-22(11-13-23)15-6-8-16(9-7-15)25(29)30/h2-3,6-9,14,17-18H,4-5,10-13H2,1H3/t14-,17-,18+/m0/s1 |
| InChIKey | NHMQUGWTJOIDLJ-JCGIZDLHSA-N |
| XLogP | 1.58 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|