C14H22ClN2+ — CID 127039294
4-(4-chlorophenyl)-1,1-diethylpiperazin-1-ium (PubChem CID 127039294) has the molecular formula C14H22ClN2+ and a molecular weight of 253.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,1-diethylpiperazin-1-ium.
| Compound Name | 4-(4-chlorophenyl)-1,1-diethylpiperazin-1-ium |
|---|---|
| PubChem CID | 127039294 |
| Molecular Formula | C14H22ClN2+ |
| Molecular Weight | 253.80 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(4-chlorophenyl)-1,1-diethylpiperazin-1-ium |
| SMILES | CC[N+]1(CC)CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H22ClN2/c1-3-17(4-2)11-9-16(10-12-17)14-7-5-13(15)6-8-14/h5-8H,3-4,9-12H2,1-2H3/q+1 |
| InChIKey | JJJPLNRLPBKKAE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|