C14H23N2O+ — CID 127039966
3-(4,4-diethylpiperazin-4-ium-1-yl)phenol (PubChem CID 127039966) has the molecular formula C14H23N2O+ and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-(4,4-diethylpiperazin-4-ium-1-yl)phenol.
| Compound Name | 3-(4,4-diethylpiperazin-4-ium-1-yl)phenol |
|---|---|
| PubChem CID | 127039966 |
| Molecular Formula | C14H23N2O+ |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 3-(4,4-diethylpiperazin-4-ium-1-yl)phenol |
| SMILES | CC[N+]1(CC)CCN(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-3-16(4-2)10-8-15(9-11-16)13-6-5-7-14(17)12-13/h5-7,12H,3-4,8-11H2,1-2H3/p+1 |
| InChIKey | KAQHTPJLPAZOEY-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|