C16H27N3 — CID 127041194
(1R,2R,3R,5S)-N-[(2-ethyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 127041194) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N-[(2-ethyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-N-[(2-ethyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 127041194 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (1R,2R,3R,5S)-N-[(2-ethyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | CCc1ncc(CN[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)[nH]1 |
| InChI | InChI=1S/C16H27N3/c1-5-15-18-9-12(19-15)8-17-14-7-11-6-13(10(14)2)16(11,3)4/h9-11,13-14,17H,5-8H2,1-4H3,(H,18,19)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | HBRKTBSLLSFUPS-ZMJPVWNMSA-N |
| XLogP | 3.13 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |