C20H26O4 — CID 127041906
(4aR,10aS,11R,11bR)-11-hydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-7,9-dione (PubChem CID 127041906) has the molecular formula C20H26O4 and a molecular weight of 330.40 g/mol. Its IUPAC name is (4aR,10aS,11R,11bR)-11-hydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-7,9-dione.
| Compound Name | (4aR,10aS,11R,11bR)-11-hydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-7,9-dione |
|---|---|
| PubChem CID | 127041906 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (4aR,10aS,11R,11bR)-11-hydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,10a,11-octahydronaphtho[2,1-f][1]benzofuran-7,9-dione |
| SMILES | CC1=C2[C@@H]([C@@H](C3=C(C2=O)CC[C@H]4[C@]3(CCCC4(C)C)C)O)OC1=O |
| InChI | InChI=1S/C20H26O4/c1-10-13-15(21)11-6-7-12-19(2,3)8-5-9-20(12,4)14(11)16(22)17(13)24-18(10)23/h12,16-17,22H,5-9H2,1-4H3/t12-,16-,17+,20-/m1/s1 |
| InChIKey | QRIJKODYPMIMSS-IZZHEETASA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | 711 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |