C20H30O4 — CID 118722631
(1R,3aR,5aS,6R,9aR,11aR)-1-hydroxy-6,9a,11a-trimethyl-2,3a,4,5,5a,7,8,9,10,11-decahydro-1H-naphtho[1,2-g][1]benzofuran-6-carboxylic acid (PubChem CID 118722631) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,3aR,5aS,6R,9aR,11aR)-1-hydroxy-6,9a,11a-trimethyl-2,3a,4,5,5a,7,8,9,10,11-decahydro-1H-naphtho[1,2-g][1]benzofuran-6-carboxylic acid.
| Compound Name | (1R,3aR,5aS,6R,9aR,11aR)-1-hydroxy-6,9a,11a-trimethyl-2,3a,4,5,5a,7,8,9,10,11-decahydro-1H-naphtho[1,2-g][1]benzofuran-6-carboxylic acid |
|---|---|
| PubChem CID | 118722631 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,3aR,5aS,6R,9aR,11aR)-1-hydroxy-6,9a,11a-trimethyl-2,3a,4,5,5a,7,8,9,10,11-decahydro-1H-naphtho[1,2-g][1]benzofuran-6-carboxylic acid |
| SMILES | C[C@]12CCC3=C(CC[C@@H]4[C@](C)(C(=O)O)CCC[C@@]34C)[C@H]1OC[C@@H]2O |
| InChI | InChI=1S/C20H30O4/c1-18-8-4-9-19(2,17(22)23)14(18)6-5-12-13(18)7-10-20(3)15(21)11-24-16(12)20/h14-16,21H,4-11H2,1-3H3,(H,22,23)/t14-,15-,16+,18-,19+,20+/m0/s1 |
| InChIKey | DHNPDIUJAHKZCY-LOBZHTCKSA-N |
| XLogP | 3.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|