C23H26F3NO3 — CID 127042480
ethyl 2-[[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]pentanoate (PubChem CID 127042480) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is ethyl 2-[[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]pentanoate.
| Compound Name | ethyl 2-[[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]pentanoate |
|---|---|
| PubChem CID | 127042480 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl 2-[[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]pentanoate |
| SMILES | CCCC(Cc1ccc(C(=O)NCc2ccccc2C(F)(F)F)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H26F3NO3/c1-3-7-18(22(29)30-4-2)14-16-10-12-17(13-11-16)21(28)27-15-19-8-5-6-9-20(19)23(24,25)26/h5-6,8-13,18H,3-4,7,14-15H2,1-2H3,(H,27,28) |
| InChIKey | PQHAVRUXNDRGCG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |