C23H22N4O3 — CID 127043134
2-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-4-methoxyphenyl]benzoic acid (PubChem CID 127043134) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-4-methoxyphenyl]benzoic acid.
| Compound Name | 2-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-4-methoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 127043134 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-4-methoxyphenyl]benzoic acid |
| SMILES | CCc1nc(N)nc(N)c1C#CCc1cc(-c2ccccc2C(=O)O)ccc1OC |
| InChI | InChI=1S/C23H22N4O3/c1-3-19-18(21(24)27-23(25)26-19)10-6-7-15-13-14(11-12-20(15)30-2)16-8-4-5-9-17(16)22(28)29/h4-5,8-9,11-13H,3,7H2,1-2H3,(H,28,29)(H4,24,25,26,27) |
| InChIKey | MUUCGSVEZHLUSR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|