C25H26FN5O4S — CID 127043334
ethyl 4-[4-[(4-fluorophenyl)sulfonylamino]butylamino]-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 127043334) has the molecular formula C25H26FN5O4S and a molecular weight of 511.58 g/mol. Its IUPAC name is ethyl 4-[4-[(4-fluorophenyl)sulfonylamino]butylamino]-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-[4-[(4-fluorophenyl)sulfonylamino]butylamino]-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 127043334 |
| Molecular Formula | C25H26FN5O4S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | ethyl 4-[4-[(4-fluorophenyl)sulfonylamino]butylamino]-1-phenylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(cnn2-c2ccccc2)c1NCCCCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FN5O4S/c1-2-35-25(32)22-16-28-24-21(17-29-31(24)19-8-4-3-5-9-19)23(22)27-14-6-7-15-30-36(33,34)20-12-10-18(26)11-13-20/h3-5,8-13,16-17,30H,2,6-7,14-15H2,1H3,(H,27,28) |
| InChIKey | PDAFEZJQDUZZKR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|