C23H32ClNO2 — CID 127043453
1-[2-(3-methoxyphenyl)ethyl]-4-[2-(4-methoxyphenyl)ethyl]piperidine;hydrochloride (PubChem CID 127043453) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenyl)ethyl]-4-[2-(4-methoxyphenyl)ethyl]piperidine;hydrochloride.
| Compound Name | 1-[2-(3-methoxyphenyl)ethyl]-4-[2-(4-methoxyphenyl)ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 127043453 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[2-(3-methoxyphenyl)ethyl]-4-[2-(4-methoxyphenyl)ethyl]piperidine;hydrochloride |
| SMILES | COc1ccc(CCC2CCN(CCc3cccc(OC)c3)CC2)cc1.Cl |
| InChI | InChI=1S/C23H31NO2.ClH/c1-25-22-10-8-19(9-11-22)6-7-20-12-15-24(16-13-20)17-14-21-4-3-5-23(18-21)26-2;/h3-5,8-11,18,20H,6-7,12-17H2,1-2H3;1H |
| InChIKey | KXFRYZRPQKODRC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |