C23H30FNO2 — CID 90423652
4-[1-fluoro-2-(4-methoxyphenyl)ethyl]-1-[2-(3-methoxyphenyl)ethyl]piperidine (PubChem CID 90423652) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-[1-fluoro-2-(4-methoxyphenyl)ethyl]-1-[2-(3-methoxyphenyl)ethyl]piperidine.
| Compound Name | 4-[1-fluoro-2-(4-methoxyphenyl)ethyl]-1-[2-(3-methoxyphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 90423652 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 4-[1-fluoro-2-(4-methoxyphenyl)ethyl]-1-[2-(3-methoxyphenyl)ethyl]piperidine |
| SMILES | COc1ccc(CC(F)C2CCN(CCc3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C23H30FNO2/c1-26-21-8-6-19(7-9-21)17-23(24)20-11-14-25(15-12-20)13-10-18-4-3-5-22(16-18)27-2/h3-9,16,20,23H,10-15,17H2,1-2H3 |
| InChIKey | ULBMYTKOPQBILJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |